C17H28FN3 — CID 123269892
6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine (PubChem CID 123269892) has the molecular formula C17H28FN3 and a molecular weight of 293.43 g/mol. Its IUPAC name is 6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine.
| Compound Name | 6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine |
|---|---|
| PubChem CID | 123269892 |
| Molecular Formula | C17H28FN3 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]piperidin-2-amine |
| SMILES | CC1CC(C2NCCC=C2C2CCCC(N)N2)C=CC1F |
| InChI | InChI=1S/C17H28FN3/c1-11-10-12(7-8-14(11)18)17-13(4-3-9-20-17)15-5-2-6-16(19)21-15/h4,7-8,11-12,14-17,20-21H,2-3,5-6,9-10,19H2,1H3 |
| InChIKey | XRZDBTXGZRQAEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|