C16H25ClFN3 — CID 123845159
2-chloro-4-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,3-diazinane (PubChem CID 123845159) has the molecular formula C16H25ClFN3 and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-chloro-4-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,3-diazinane.
| Compound Name | 2-chloro-4-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,3-diazinane |
|---|---|
| PubChem CID | 123845159 |
| Molecular Formula | C16H25ClFN3 |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-chloro-4-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,3-diazinane |
| SMILES | CC1CC(C2NCCC=C2C2CCNC(Cl)N2)C=CC1F |
| InChI | InChI=1S/C16H25ClFN3/c1-10-9-11(4-5-13(10)18)15-12(3-2-7-19-15)14-6-8-20-16(17)21-14/h3-5,10-11,13-16,19-21H,2,6-9H2,1H3 |
| InChIKey | ZMENAZKJKRQPKU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|