C19H37N — CID 123773852
N,3,3,6,11-pentamethyltetradeca-1,5-dien-7-amine (PubChem CID 123773852) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is N,3,3,6,11-pentamethyltetradeca-1,5-dien-7-amine.
| Compound Name | N,3,3,6,11-pentamethyltetradeca-1,5-dien-7-amine |
|---|---|
| PubChem CID | 123773852 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | N,3,3,6,11-pentamethyltetradeca-1,5-dien-7-amine |
| SMILES | C=CC(C)(C)CC=C(C)C(CCCC(C)CCC)NC |
| InChI | InChI=1S/C19H37N/c1-8-11-16(3)12-10-13-18(20-7)17(4)14-15-19(5,6)9-2/h9,14,16,18,20H,2,8,10-13,15H2,1,3-7H3 |
| InChIKey | SSZLOTVEBOGYBJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|