C25H51N — CID 122500269
(Z)-3-[(2S)-2,3-dimethylbutyl]-6-methyl-N-[(3R)-2,2,4-trimethylpentan-3-yl]dec-7-en-2-amine (PubChem CID 122500269) has the molecular formula C25H51N and a molecular weight of 365.69 g/mol. Its IUPAC name is (Z)-3-[(2S)-2,3-dimethylbutyl]-6-methyl-N-[(3R)-2,2,4-trimethylpentan-3-yl]dec-7-en-2-amine.
| Compound Name | (Z)-3-[(2S)-2,3-dimethylbutyl]-6-methyl-N-[(3R)-2,2,4-trimethylpentan-3-yl]dec-7-en-2-amine |
|---|---|
| PubChem CID | 122500269 |
| Molecular Formula | C25H51N |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 365.40 |
| IUPAC Name | (Z)-3-[(2S)-2,3-dimethylbutyl]-6-methyl-N-[(3R)-2,2,4-trimethylpentan-3-yl]dec-7-en-2-amine |
| SMILES | CC/C=C\C(C)CCC(C[C@H](C)C(C)C)C(C)N[C@H](C(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H51N/c1-12-13-14-20(6)15-16-23(17-21(7)18(2)3)22(8)26-24(19(4)5)25(9,10)11/h13-14,18-24,26H,12,15-17H2,1-11H3/b14-13-/t20?,21-,22?,23?,24+/m0/s1 |
| InChIKey | VVCIHIGFZXPEKU-OROLDSDYSA-N |
| XLogP | 7.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|