C20H39N — CID 143719601
ethane;(3E,5Z)-N,3,6-trimethyl-2-(3-methylhexan-3-yl)octa-3,5,7-trien-1-amine (PubChem CID 143719601) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is ethane;(3E,5Z)-N,3,6-trimethyl-2-(3-methylhexan-3-yl)octa-3,5,7-trien-1-amine.
| Compound Name | ethane;(3E,5Z)-N,3,6-trimethyl-2-(3-methylhexan-3-yl)octa-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 143719601 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | ethane;(3E,5Z)-N,3,6-trimethyl-2-(3-methylhexan-3-yl)octa-3,5,7-trien-1-amine |
| SMILES | C=C/C(C)=C\C=C(/C)C(CNC)C(C)(CC)CCC.CC |
| InChI | InChI=1S/C18H33N.C2H6/c1-8-13-18(6,10-3)17(14-19-7)16(5)12-11-15(4)9-2;1-2/h9,11-12,17,19H,2,8,10,13-14H2,1,3-7H3;1-2H3/b15-11-,16-12+; |
| InChIKey | JHRSCWIIMNFRMD-GVWAAWDCSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|