C27H44FN — CID 123592441
N-[[4-[4-(2-fluoro-2,3,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-yl]-3-methylcyclohexa-1,5-dien-1-yl]methyl]propan-1-amine (PubChem CID 123592441) has the molecular formula C27H44FN and a molecular weight of 401.65 g/mol. Its IUPAC name is N-[[4-[4-(2-fluoro-2,3,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-yl]-3-methylcyclohexa-1,5-dien-1-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-[4-(2-fluoro-2,3,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-yl]-3-methylcyclohexa-1,5-dien-1-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 123592441 |
| Molecular Formula | C27H44FN |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | N-[[4-[4-(2-fluoro-2,3,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-yl]-3-methylcyclohexa-1,5-dien-1-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1=CC(C)C(C2C=CC(C(C)(CC(C)(C)C)C(C)(C)F)=CC2)C=C1 |
| InChI | InChI=1S/C27H44FN/c1-9-16-29-18-21-10-15-24(20(2)17-21)22-11-13-23(14-12-22)27(8,26(6,7)28)19-25(3,4)5/h10-11,13-15,17,20,22,24,29H,9,12,16,18-19H2,1-8H3 |
| InChIKey | OCTURSWLHJXSEY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|