C27H54N2 — CID 156741346
1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine;ethane (PubChem CID 156741346) has the molecular formula C27H54N2 and a molecular weight of 406.74 g/mol. Its IUPAC name is 1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine;ethane.
| Compound Name | 1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine;ethane |
|---|---|
| PubChem CID | 156741346 |
| Molecular Formula | C27H54N2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.43 |
| IUPAC Name | 1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine;ethane |
| SMILES | C=C/C=C(C)\C=C/CNC(C)N(CC)CCC(C)CC(CC)(CC)C(C)C.CC |
| InChI | InChI=1S/C25H48N2.C2H6/c1-10-15-22(7)16-14-18-26-24(9)27(13-4)19-17-23(8)20-25(11-2,12-3)21(5)6;1-2/h10,14-16,21,23-24,26H,1,11-13,17-20H2,2-9H3;1-2H3/b16-14-,22-15-; |
| InChIKey | PQSYLNQQSAQHRT-BFEKZPDQSA-N |
| XLogP | 7.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|