C29H55N3 — CID 134270335
(2S)-1-N-[(3E,5Z,9Z)-2-hex-5-en-2-yl-4,8-dimethyldodeca-3,5,9-trienyl]-1-N',1-N',5-N,2-tetramethylpentane-1,1,5-triamine (PubChem CID 134270335) has the molecular formula C29H55N3 and a molecular weight of 445.78 g/mol. Its IUPAC name is (2S)-1-N-[(3E,5Z,9Z)-2-hex-5-en-2-yl-4,8-dimethyldodeca-3,5,9-trienyl]-1-N',1-N',5-N,2-tetramethylpentane-1,1,5-triamine.
| Compound Name | (2S)-1-N-[(3E,5Z,9Z)-2-hex-5-en-2-yl-4,8-dimethyldodeca-3,5,9-trienyl]-1-N',1-N',5-N,2-tetramethylpentane-1,1,5-triamine |
|---|---|
| PubChem CID | 134270335 |
| Molecular Formula | C29H55N3 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 445.44 |
| IUPAC Name | (2S)-1-N-[(3E,5Z,9Z)-2-hex-5-en-2-yl-4,8-dimethyldodeca-3,5,9-trienyl]-1-N',1-N',5-N,2-tetramethylpentane-1,1,5-triamine |
| SMILES | C=CCCC(C)C(/C=C(C)/C=C\CC(C)/C=C\CC)CNC([C@@H](C)CCCNC)N(C)C |
| InChI | InChI=1S/C29H55N3/c1-10-12-16-24(3)17-14-18-25(4)22-28(26(5)19-13-11-2)23-31-29(32(8)9)27(6)20-15-21-30-7/h11-12,14,16,18,22,24,26-31H,2,10,13,15,17,19-21,23H2,1,3-9H3/b16-12-,18-14-,25-22+/t24?,26?,27-,28?,29?/m0/s1 |
| InChIKey | QKIBZRNTRIZLOR-TYHNINLZSA-N |
| XLogP | 6.81 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|