C17H32N2 — CID 126514930
(E,2Z)-2-(1-cyclopropylpropylidene)-1-N-methyl-1-N'-propylhept-3-ene-1,1-diamine (PubChem CID 126514930) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (E,2Z)-2-(1-cyclopropylpropylidene)-1-N-methyl-1-N'-propylhept-3-ene-1,1-diamine.
| Compound Name | (E,2Z)-2-(1-cyclopropylpropylidene)-1-N-methyl-1-N'-propylhept-3-ene-1,1-diamine |
|---|---|
| PubChem CID | 126514930 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | (E,2Z)-2-(1-cyclopropylpropylidene)-1-N-methyl-1-N'-propylhept-3-ene-1,1-diamine |
| SMILES | CCC/C=C/C(=C(\CC)C1CC1)C(NC)NCCC |
| InChI | InChI=1S/C17H32N2/c1-5-8-9-10-16(15(7-3)14-11-12-14)17(18-4)19-13-6-2/h9-10,14,17-19H,5-8,11-13H2,1-4H3/b10-9+,16-15- |
| InChIKey | GIUXSHCHMXQSLP-WXJFLGMWSA-N |
| XLogP | 4.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|