C21H42N2 — CID 166735088
(Z)-1-N,3,4,6-tetramethyl-1-N'-[(E)-7-methylnon-3-en-2-yl]hept-3-ene-1,1-diamine (PubChem CID 166735088) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is (Z)-1-N,3,4,6-tetramethyl-1-N'-[(E)-7-methylnon-3-en-2-yl]hept-3-ene-1,1-diamine.
| Compound Name | (Z)-1-N,3,4,6-tetramethyl-1-N'-[(E)-7-methylnon-3-en-2-yl]hept-3-ene-1,1-diamine |
|---|---|
| PubChem CID | 166735088 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | (Z)-1-N,3,4,6-tetramethyl-1-N'-[(E)-7-methylnon-3-en-2-yl]hept-3-ene-1,1-diamine |
| SMILES | CCC(C)CC/C=C/C(C)NC(C/C(C)=C(/C)CC(C)C)NC |
| InChI | InChI=1S/C21H42N2/c1-9-17(4)12-10-11-13-20(7)23-21(22-8)15-19(6)18(5)14-16(2)3/h11,13,16-17,20-23H,9-10,12,14-15H2,1-8H3/b13-11+,19-18- |
| InChIKey | YUUQRJTVSHNRMF-UORIEYFGSA-N |
| XLogP | 5.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|