C27H41N3 — CID 142424997
(2E,4E,6E,8E,10E,12Z,15E)-N-(1-amino-5-methylhepta-2,6-dienyl)-5,10-dimethylheptadeca-2,4,6,8,10,12,15-heptaene-1,17-diamine (PubChem CID 142424997) has the molecular formula C27H41N3 and a molecular weight of 407.65 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12Z,15E)-N-(1-amino-5-methylhepta-2,6-dienyl)-5,10-dimethylheptadeca-2,4,6,8,10,12,15-heptaene-1,17-diamine.
| Compound Name | (2E,4E,6E,8E,10E,12Z,15E)-N-(1-amino-5-methylhepta-2,6-dienyl)-5,10-dimethylheptadeca-2,4,6,8,10,12,15-heptaene-1,17-diamine |
|---|---|
| PubChem CID | 142424997 |
| Molecular Formula | C27H41N3 |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 407.33 |
| IUPAC Name | (2E,4E,6E,8E,10E,12Z,15E)-N-(1-amino-5-methylhepta-2,6-dienyl)-5,10-dimethylheptadeca-2,4,6,8,10,12,15-heptaene-1,17-diamine |
| SMILES | C=CC(C)CC=CC(N)NC/C=C/C=C(C)/C=C/C=C/C(C)=C/C=C\C/C=C/CN |
| InChI | InChI=1S/C27H41N3/c1-5-24(2)20-15-21-27(29)30-23-14-12-19-26(4)18-11-10-17-25(3)16-9-7-6-8-13-22-28/h5,7-19,21,24,27,30H,1,6,20,22-23,28-29H2,2-4H3/b9-7-,13-8+,14-12+,17-10+,18-11+,21-15?,25-16+,26-19+ |
| InChIKey | VLKHZZMQAXNPKL-YDXSHQSMSA-N |
| XLogP | 5.65 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|