C25H44N2 — CID 143357455
1-N'-[1-[(4Z,6Z)-3,8-dimethylcyclonona-4,6-dien-1-yl]but-3-enyl]-1-N-(2,2-dimethylhexan-3-yl)ethene-1,1-diamine (PubChem CID 143357455) has the molecular formula C25H44N2 and a molecular weight of 372.64 g/mol. Its IUPAC name is 1-N'-[1-[(4Z,6Z)-3,8-dimethylcyclonona-4,6-dien-1-yl]but-3-enyl]-1-N-(2,2-dimethylhexan-3-yl)ethene-1,1-diamine.
| Compound Name | 1-N'-[1-[(4Z,6Z)-3,8-dimethylcyclonona-4,6-dien-1-yl]but-3-enyl]-1-N-(2,2-dimethylhexan-3-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 143357455 |
| Molecular Formula | C25H44N2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.35 |
| IUPAC Name | 1-N'-[1-[(4Z,6Z)-3,8-dimethylcyclonona-4,6-dien-1-yl]but-3-enyl]-1-N-(2,2-dimethylhexan-3-yl)ethene-1,1-diamine |
| SMILES | C=CCC(NC(=C)NC(CCC)C(C)(C)C)C1CC(C)/C=C\C=C/C(C)C1 |
| InChI | InChI=1S/C25H44N2/c1-9-13-23(22-17-19(3)15-11-12-16-20(4)18-22)26-21(5)27-24(14-10-2)25(6,7)8/h9,11-12,15-16,19-20,22-24,26-27H,1,5,10,13-14,17-18H2,2-4,6-8H3/b15-11-,16-12- |
| InChIKey | NIFYYXGIUQLBEY-NFLUSIDLSA-N |
| XLogP | 6.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|