C36H69N3 — CID 176994715
5-N-[1-[[(Z,7S)-2,2-dimethyl-4,8-dimethylidenehexadec-13-en-7-yl]amino]ethenyl]-8,8-dimethyl-6-methylidenenonane-1,5-diamine;ethane (PubChem CID 176994715) has the molecular formula C36H69N3 and a molecular weight of 543.97 g/mol. Its IUPAC name is 5-N-[1-[[(Z,7S)-2,2-dimethyl-4,8-dimethylidenehexadec-13-en-7-yl]amino]ethenyl]-8,8-dimethyl-6-methylidenenonane-1,5-diamine;ethane.
| Compound Name | 5-N-[1-[[(Z,7S)-2,2-dimethyl-4,8-dimethylidenehexadec-13-en-7-yl]amino]ethenyl]-8,8-dimethyl-6-methylidenenonane-1,5-diamine;ethane |
|---|---|
| PubChem CID | 176994715 |
| Molecular Formula | C36H69N3 |
| Molecular Weight | 543.97 g/mol |
| Exact Mass | 543.55 |
| IUPAC Name | 5-N-[1-[[(Z,7S)-2,2-dimethyl-4,8-dimethylidenehexadec-13-en-7-yl]amino]ethenyl]-8,8-dimethyl-6-methylidenenonane-1,5-diamine;ethane |
| SMILES | C=C(CC[C@H](NC(=C)NC(CCCCN)C(=C)CC(C)(C)C)C(=C)CCCC/C=C\CC)CC(C)(C)C.CC |
| InChI | InChI=1S/C34H63N3.C2H6/c1-12-13-14-15-16-17-20-28(3)32(23-22-27(2)25-33(6,7)8)37-30(5)36-31(21-18-19-24-35)29(4)26-34(9,10)11;1-2/h13-14,31-32,36-37H,2-5,12,15-26,35H2,1,6-11H3;1-2H3/b14-13-;/t31?,32-;/m0./s1 |
| InChIKey | KCTMSSNUOBKDOV-KBVOTDFLSA-N |
| XLogP | 10.38 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.97 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|