C23H44N4 — CID 142182261
(4S)-4-N-[1-(2,4-dimethylpent-1-en-3-ylamino)ethenyl]-7,7-dimethyl-1-N-[1-(methylamino)ethenyl]-5-methylideneoctane-1,4-diamine (PubChem CID 142182261) has the molecular formula C23H44N4 and a molecular weight of 376.63 g/mol. Its IUPAC name is (4S)-4-N-[1-(2,4-dimethylpent-1-en-3-ylamino)ethenyl]-7,7-dimethyl-1-N-[1-(methylamino)ethenyl]-5-methylideneoctane-1,4-diamine.
| Compound Name | (4S)-4-N-[1-(2,4-dimethylpent-1-en-3-ylamino)ethenyl]-7,7-dimethyl-1-N-[1-(methylamino)ethenyl]-5-methylideneoctane-1,4-diamine |
|---|---|
| PubChem CID | 142182261 |
| Molecular Formula | C23H44N4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | (4S)-4-N-[1-(2,4-dimethylpent-1-en-3-ylamino)ethenyl]-7,7-dimethyl-1-N-[1-(methylamino)ethenyl]-5-methylideneoctane-1,4-diamine |
| SMILES | C=C(NC)NCCC[C@H](NC(=C)NC(C(=C)C)C(C)C)C(=C)CC(C)(C)C |
| InChI | InChI=1S/C23H44N4/c1-16(2)22(17(3)4)27-20(7)26-21(18(5)15-23(8,9)10)13-12-14-25-19(6)24-11/h17,21-22,24-27H,1,5-7,12-15H2,2-4,8-11H3/t21-,22?/m0/s1 |
| InChIKey | JNLPCZOACCURLM-HMTLIYDFSA-N |
| XLogP | 4.66 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|