C31H62N2 — CID 134171508
1-N-(3,3,6,6,8,9-hexamethylundec-10-enyl)-1-N'-(2,2,5,5-tetramethyloctyl)ethene-1,1-diamine (PubChem CID 134171508) has the molecular formula C31H62N2 and a molecular weight of 462.85 g/mol. Its IUPAC name is 1-N-(3,3,6,6,8,9-hexamethylundec-10-enyl)-1-N'-(2,2,5,5-tetramethyloctyl)ethene-1,1-diamine.
| Compound Name | 1-N-(3,3,6,6,8,9-hexamethylundec-10-enyl)-1-N'-(2,2,5,5-tetramethyloctyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 134171508 |
| Molecular Formula | C31H62N2 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.49 |
| IUPAC Name | 1-N-(3,3,6,6,8,9-hexamethylundec-10-enyl)-1-N'-(2,2,5,5-tetramethyloctyl)ethene-1,1-diamine |
| SMILES | C=CC(C)C(C)CC(C)(C)CCC(C)(C)CCNC(=C)NCC(C)(C)CCC(C)(C)CCC |
| InChI | InChI=1S/C31H62N2/c1-14-16-28(6,7)18-20-31(12,13)24-33-27(5)32-22-21-29(8,9)17-19-30(10,11)23-26(4)25(3)15-2/h15,25-26,32-33H,2,5,14,16-24H2,1,3-4,6-13H3 |
| InChIKey | XLUGCCUNZUORMA-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|