C19H39N — CID 146539500
7-ethyl-N,4,5-trimethyl-4-propylundec-10-en-1-amine (PubChem CID 146539500) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is 7-ethyl-N,4,5-trimethyl-4-propylundec-10-en-1-amine.
| Compound Name | 7-ethyl-N,4,5-trimethyl-4-propylundec-10-en-1-amine |
|---|---|
| PubChem CID | 146539500 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 7-ethyl-N,4,5-trimethyl-4-propylundec-10-en-1-amine |
| SMILES | C=CCCC(CC)CC(C)C(C)(CCC)CCCNC |
| InChI | InChI=1S/C19H39N/c1-7-10-12-18(9-3)16-17(4)19(5,13-8-2)14-11-15-20-6/h7,17-18,20H,1,8-16H2,2-6H3 |
| InChIKey | UCMREQDYCMUJIS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|