C19H34F3N — CID 174191834
2-prop-2-enyl-2-propyl-N-(8,8,8-trifluorooctyl)pent-4-en-1-amine (PubChem CID 174191834) has the molecular formula C19H34F3N and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-prop-2-enyl-2-propyl-N-(8,8,8-trifluorooctyl)pent-4-en-1-amine.
| Compound Name | 2-prop-2-enyl-2-propyl-N-(8,8,8-trifluorooctyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 174191834 |
| Molecular Formula | C19H34F3N |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 2-prop-2-enyl-2-propyl-N-(8,8,8-trifluorooctyl)pent-4-en-1-amine |
| SMILES | C=CCC(CC=C)(CCC)CNCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C19H34F3N/c1-4-12-18(13-5-2,14-6-3)17-23-16-11-9-7-8-10-15-19(20,21)22/h4-5,23H,1-2,6-17H2,3H3 |
| InChIKey | ATZFHIGVFHXJIP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|