C19H38N2 — CID 152634778
5,5-bis(ethenyl)-1-N,1-N'-di(propan-2-yl)nonane-1,1-diamine (PubChem CID 152634778) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 5,5-bis(ethenyl)-1-N,1-N'-di(propan-2-yl)nonane-1,1-diamine.
| Compound Name | 5,5-bis(ethenyl)-1-N,1-N'-di(propan-2-yl)nonane-1,1-diamine |
|---|---|
| PubChem CID | 152634778 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 5,5-bis(ethenyl)-1-N,1-N'-di(propan-2-yl)nonane-1,1-diamine |
| SMILES | C=CC(C=C)(CCCC)CCCC(NC(C)C)NC(C)C |
| InChI | InChI=1S/C19H38N2/c1-8-11-14-19(9-2,10-3)15-12-13-18(20-16(4)5)21-17(6)7/h9-10,16-18,20-21H,2-3,8,11-15H2,1,4-7H3 |
| InChIKey | ZEHNMWUQGTXOKL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|