C17H35N — CID 90804437
6-ethenyl-7-ethyl-N,5,6,8-tetramethylnonan-1-amine (PubChem CID 90804437) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 6-ethenyl-7-ethyl-N,5,6,8-tetramethylnonan-1-amine.
| Compound Name | 6-ethenyl-7-ethyl-N,5,6,8-tetramethylnonan-1-amine |
|---|---|
| PubChem CID | 90804437 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 6-ethenyl-7-ethyl-N,5,6,8-tetramethylnonan-1-amine |
| SMILES | C=CC(C)(C(C)CCCCNC)C(CC)C(C)C |
| InChI | InChI=1S/C17H35N/c1-8-16(14(3)4)17(6,9-2)15(5)12-10-11-13-18-7/h9,14-16,18H,2,8,10-13H2,1,3-7H3 |
| InChIKey | POGVKVQUOSLFJH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|