C25H49N — CID 70383627
N-[3-[1-[(2R)-2-propan-2-ylbut-3-enyl]cyclohexyl]propyl]nonan-1-amine (PubChem CID 70383627) has the molecular formula C25H49N and a molecular weight of 363.67 g/mol. Its IUPAC name is N-[3-[1-[(2R)-2-propan-2-ylbut-3-enyl]cyclohexyl]propyl]nonan-1-amine.
| Compound Name | N-[3-[1-[(2R)-2-propan-2-ylbut-3-enyl]cyclohexyl]propyl]nonan-1-amine |
|---|---|
| PubChem CID | 70383627 |
| Molecular Formula | C25H49N |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 363.39 |
| IUPAC Name | N-[3-[1-[(2R)-2-propan-2-ylbut-3-enyl]cyclohexyl]propyl]nonan-1-amine |
| SMILES | C=C[C@H](CC1(CCCNCCCCCCCCC)CCCCC1)C(C)C |
| InChI | InChI=1S/C25H49N/c1-5-7-8-9-10-11-15-20-26-21-16-19-25(17-13-12-14-18-25)22-24(6-2)23(3)4/h6,23-24,26H,2,5,7-22H2,1,3-4H3/t24-/m1/s1 |
| InChIKey | OXYFVORRBZLANV-XMMPIXPASA-N |
| XLogP | 7.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|