C23H44N2 — CID 143358144
1-N-(2,5-dimethyl-6-methylideneoctan-3-yl)-1-N'-(2,5,5-trimethylhept-1-en-4-yl)ethene-1,1-diamine (PubChem CID 143358144) has the molecular formula C23H44N2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 1-N-(2,5-dimethyl-6-methylideneoctan-3-yl)-1-N'-(2,5,5-trimethylhept-1-en-4-yl)ethene-1,1-diamine.
| Compound Name | 1-N-(2,5-dimethyl-6-methylideneoctan-3-yl)-1-N'-(2,5,5-trimethylhept-1-en-4-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 143358144 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | 1-N-(2,5-dimethyl-6-methylideneoctan-3-yl)-1-N'-(2,5,5-trimethylhept-1-en-4-yl)ethene-1,1-diamine |
| SMILES | C=C(C)CC(NC(=C)NC(CC(C)C(=C)CC)C(C)C)C(C)(C)CC |
| InChI | InChI=1S/C23H44N2/c1-12-18(7)19(8)15-21(17(5)6)24-20(9)25-22(14-16(3)4)23(10,11)13-2/h17,19,21-22,24-25H,3,7,9,12-15H2,1-2,4-6,8,10-11H3 |
| InChIKey | YGVRAWRADAQWQX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|