C19H36N2 — CID 143356241
1-N-(2,2-dimethylpentan-3-yl)-1-N'-[1-(1-methylcyclohexyl)prop-2-enyl]ethene-1,1-diamine (PubChem CID 143356241) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-N-(2,2-dimethylpentan-3-yl)-1-N'-[1-(1-methylcyclohexyl)prop-2-enyl]ethene-1,1-diamine.
| Compound Name | 1-N-(2,2-dimethylpentan-3-yl)-1-N'-[1-(1-methylcyclohexyl)prop-2-enyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 143356241 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 1-N-(2,2-dimethylpentan-3-yl)-1-N'-[1-(1-methylcyclohexyl)prop-2-enyl]ethene-1,1-diamine |
| SMILES | C=CC(NC(=C)NC(CC)C(C)(C)C)C1(C)CCCCC1 |
| InChI | InChI=1S/C19H36N2/c1-8-16(18(4,5)6)20-15(3)21-17(9-2)19(7)13-11-10-12-14-19/h9,16-17,20-21H,2-3,8,10-14H2,1,4-7H3 |
| InChIKey | HEDBFGSNQWXZON-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|