C18H32N2 — CID 163824197
1-cyclohepta-2,4-dien-1-yl-N'-[(2S)-2-ethyl-2-methylcyclohexyl]-N-methylmethanediamine (PubChem CID 163824197) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 1-cyclohepta-2,4-dien-1-yl-N'-[(2S)-2-ethyl-2-methylcyclohexyl]-N-methylmethanediamine.
| Compound Name | 1-cyclohepta-2,4-dien-1-yl-N'-[(2S)-2-ethyl-2-methylcyclohexyl]-N-methylmethanediamine |
|---|---|
| PubChem CID | 163824197 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1-cyclohepta-2,4-dien-1-yl-N'-[(2S)-2-ethyl-2-methylcyclohexyl]-N-methylmethanediamine |
| SMILES | CC[C@@]1(C)CCCCC1NC(NC)C1C=CC=CCC1 |
| InChI | InChI=1S/C18H32N2/c1-4-18(2)14-10-9-13-16(18)20-17(19-3)15-11-7-5-6-8-12-15/h5-7,11,15-17,19-20H,4,8-10,12-14H2,1-3H3/t15?,16?,17?,18-/m0/s1 |
| InChIKey | NYAABHTYNMDCEA-HLYMMOCJSA-N |
| XLogP | 4.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|