C23H42N2 — CID 143362035
1-N-[(Z)-3-but-3-enyl-5-methyloct-6-en-2-yl]-1-N'-oct-7-en-3-ylethene-1,1-diamine (PubChem CID 143362035) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 1-N-[(Z)-3-but-3-enyl-5-methyloct-6-en-2-yl]-1-N'-oct-7-en-3-ylethene-1,1-diamine.
| Compound Name | 1-N-[(Z)-3-but-3-enyl-5-methyloct-6-en-2-yl]-1-N'-oct-7-en-3-ylethene-1,1-diamine |
|---|---|
| PubChem CID | 143362035 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | 1-N-[(Z)-3-but-3-enyl-5-methyloct-6-en-2-yl]-1-N'-oct-7-en-3-ylethene-1,1-diamine |
| SMILES | C=CCCCC(CC)NC(=C)NC(C)C(CCC=C)CC(C)/C=C\C |
| InChI | InChI=1S/C23H42N2/c1-8-12-14-17-23(11-4)25-21(7)24-20(6)22(16-13-9-2)18-19(5)15-10-3/h8-10,15,19-20,22-25H,1-2,7,11-14,16-18H2,3-6H3/b15-10- |
| InChIKey | GIFRQYZMLCBAMF-GDNBJRDFSA-N |
| XLogP | 6.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|