C24H44N2 — CID 123137046
1-N-(4,8-dimethylnona-3,7-dien-2-yl)-2,5,9-trimethyldeca-4,8-diene-1,3-diamine (PubChem CID 123137046) has the molecular formula C24H44N2 and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-N-(4,8-dimethylnona-3,7-dien-2-yl)-2,5,9-trimethyldeca-4,8-diene-1,3-diamine.
| Compound Name | 1-N-(4,8-dimethylnona-3,7-dien-2-yl)-2,5,9-trimethyldeca-4,8-diene-1,3-diamine |
|---|---|
| PubChem CID | 123137046 |
| Molecular Formula | C24H44N2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.35 |
| IUPAC Name | 1-N-(4,8-dimethylnona-3,7-dien-2-yl)-2,5,9-trimethyldeca-4,8-diene-1,3-diamine |
| SMILES | CC(C)=CCCC(C)=CC(C)NCC(C)C(N)C=C(C)CCC=C(C)C |
| InChI | InChI=1S/C24H44N2/c1-18(2)11-9-13-20(5)15-23(8)26-17-22(7)24(25)16-21(6)14-10-12-19(3)4/h11-12,15-16,22-24,26H,9-10,13-14,17,25H2,1-8H3 |
| InChIKey | YHDGGTAORPKZKJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|