C25H35FN2 — CID 138663524
(3Z)-3-ethylidene-5-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(2-methylpropyl)-2,7-dihydro-1H-1,4-diazepine (PubChem CID 138663524) has the molecular formula C25H35FN2 and a molecular weight of 382.57 g/mol. Its IUPAC name is (3Z)-3-ethylidene-5-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(2-methylpropyl)-2,7-dihydro-1H-1,4-diazepine.
| Compound Name | (3Z)-3-ethylidene-5-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(2-methylpropyl)-2,7-dihydro-1H-1,4-diazepine |
|---|---|
| PubChem CID | 138663524 |
| Molecular Formula | C25H35FN2 |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | (3Z)-3-ethylidene-5-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(2-methylpropyl)-2,7-dihydro-1H-1,4-diazepine |
| SMILES | C=C/C=C(\C=C/C)C1=C(C2C(F)=CC=CC2C)N(CC(C)C)/C(=C\C)CNC1 |
| InChI | InChI=1S/C25H35FN2/c1-7-11-20(12-8-2)22-16-27-15-21(9-3)28(17-18(4)5)25(22)24-19(6)13-10-14-23(24)26/h7-14,18-19,24,27H,1,15-17H2,2-6H3/b12-8-,20-11+,21-9- |
| InChIKey | TUHNPXQASJLHKK-DAROWDEWSA-N |
| XLogP | 6.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|