C16H23FN2 — CID 174367307
(1S)-1-N'-[(Z)-but-2-en-2-yl]-1-N-[(5R,6R)-6-fluoro-3,5-dimethylcyclohexa-1,3-dien-1-yl]but-2-yne-1,1-diamine (PubChem CID 174367307) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is (1S)-1-N'-[(Z)-but-2-en-2-yl]-1-N-[(5R,6R)-6-fluoro-3,5-dimethylcyclohexa-1,3-dien-1-yl]but-2-yne-1,1-diamine.
| Compound Name | (1S)-1-N'-[(Z)-but-2-en-2-yl]-1-N-[(5R,6R)-6-fluoro-3,5-dimethylcyclohexa-1,3-dien-1-yl]but-2-yne-1,1-diamine |
|---|---|
| PubChem CID | 174367307 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (1S)-1-N'-[(Z)-but-2-en-2-yl]-1-N-[(5R,6R)-6-fluoro-3,5-dimethylcyclohexa-1,3-dien-1-yl]but-2-yne-1,1-diamine |
| SMILES | CC#C[C@H](NC1=CC(C)=C[C@@H](C)[C@H]1F)N/C(C)=C\C |
| InChI | InChI=1S/C16H23FN2/c1-6-8-15(18-13(5)7-2)19-14-10-11(3)9-12(4)16(14)17/h7,9-10,12,15-16,18-19H,1-5H3/b13-7-/t12-,15+,16-/m1/s1 |
| InChIKey | DUUQJOKOUJDCGW-QZKLJOCISA-N |
| XLogP | 3.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|