C13H19F3N2 — CID 142070559
2,3-dimethyl-4-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]-1,2-dihydroimidazole (PubChem CID 142070559) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2,3-dimethyl-4-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]-1,2-dihydroimidazole.
| Compound Name | 2,3-dimethyl-4-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 142070559 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2,3-dimethyl-4-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]-1,2-dihydroimidazole |
| SMILES | CC/C=C(\C=C(/C)C1=CNC(C)N1C)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-5-6-11(13(14,15)16)7-9(2)12-8-17-10(3)18(12)4/h6-8,10,17H,5H2,1-4H3/b9-7+,11-6+ |
| InChIKey | MMCJRHHFWKJBLD-HHGGOTJKSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|