C15H25F3N2 — CID 139435664
(Z)-1-N-propyl-1-N-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]but-1-ene-1,2-diamine (PubChem CID 139435664) has the molecular formula C15H25F3N2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (Z)-1-N-propyl-1-N-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]but-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-propyl-1-N-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]but-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 139435664 |
| Molecular Formula | C15H25F3N2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (Z)-1-N-propyl-1-N-[(2E,4E)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]but-1-ene-1,2-diamine |
| SMILES | CC/C=C(\C=C(/C)N(/C=C(\N)CC)CCC)C(F)(F)F |
| InChI | InChI=1S/C15H25F3N2/c1-5-8-13(15(16,17)18)10-12(4)20(9-6-2)11-14(19)7-3/h8,10-11H,5-7,9,19H2,1-4H3/b12-10+,13-8+,14-11- |
| InChIKey | UQXSBXBNZDLJOT-GXGJVPANSA-N |
| XLogP | 4.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|