C12H21F3N2 — CID 143085985
(2E,4Z)-6-N,6-N-dimethyl-3-(trifluoromethyl)hepta-2,4,6-triene-1,6-diamine;ethane (PubChem CID 143085985) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (2E,4Z)-6-N,6-N-dimethyl-3-(trifluoromethyl)hepta-2,4,6-triene-1,6-diamine;ethane.
| Compound Name | (2E,4Z)-6-N,6-N-dimethyl-3-(trifluoromethyl)hepta-2,4,6-triene-1,6-diamine;ethane |
|---|---|
| PubChem CID | 143085985 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (2E,4Z)-6-N,6-N-dimethyl-3-(trifluoromethyl)hepta-2,4,6-triene-1,6-diamine;ethane |
| SMILES | C=C(/C=C\C(=C/CN)C(F)(F)F)N(C)C.CC |
| InChI | InChI=1S/C10H15F3N2.C2H6/c1-8(15(2)3)4-5-9(6-7-14)10(11,12)13;1-2/h4-6H,1,7,14H2,2-3H3;1-2H3/b5-4-,9-6+; |
| InChIKey | LLMDAUVGJVQYRQ-QKPHYRDRSA-N |
| XLogP | 3.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|