C14H21N3 — CID 89037598
(1E)-1-(2-methyl-2,3,4,5-tetrahydrobenzimidazol-1-yl)hexa-1,5-dien-1-amine (PubChem CID 89037598) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (1E)-1-(2-methyl-2,3,4,5-tetrahydrobenzimidazol-1-yl)hexa-1,5-dien-1-amine.
| Compound Name | (1E)-1-(2-methyl-2,3,4,5-tetrahydrobenzimidazol-1-yl)hexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 89037598 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (1E)-1-(2-methyl-2,3,4,5-tetrahydrobenzimidazol-1-yl)hexa-1,5-dien-1-amine |
| SMILES | C=CCC/C=C(\N)N1C2=C(CCC=C2)NC1C |
| InChI | InChI=1S/C14H21N3/c1-3-4-5-10-14(15)17-11(2)16-12-8-6-7-9-13(12)17/h3,7,9-11,16H,1,4-6,8,15H2,2H3/b14-10+ |
| InChIKey | RUBYPOPWRGZPHL-GXDHUFHOSA-N |
| XLogP | 2.57 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|