C13H17FN2 — CID 174362794
1-N-(1-fluoro-4H-inden-5-yl)-1-N',1-N'-dimethylethane-1,1-diamine (PubChem CID 174362794) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-N-(1-fluoro-4H-inden-5-yl)-1-N',1-N'-dimethylethane-1,1-diamine.
| Compound Name | 1-N-(1-fluoro-4H-inden-5-yl)-1-N',1-N'-dimethylethane-1,1-diamine |
|---|---|
| PubChem CID | 174362794 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1-N-(1-fluoro-4H-inden-5-yl)-1-N',1-N'-dimethylethane-1,1-diamine |
| SMILES | CC(NC1=CC=C2C(F)=CC=C2C1)N(C)C |
| InChI | InChI=1S/C13H17FN2/c1-9(16(2)3)15-11-5-6-12-10(8-11)4-7-13(12)14/h4-7,9,15H,8H2,1-3H3 |
| InChIKey | DSUMSGAHXCVTKN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|