About 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine
1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine (PubChem CID 89292642) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine.
Analyze 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine?
The IUPAC name of 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine (CID 89292642) is 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine.
What is the SMILES notation for 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine?
The canonical SMILES for 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine is CC1=C2C=CCCN2CN1.
What is the InChIKey of 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine?
The InChIKey is QISGDKXWJIENMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-7-8-4-2-3-5-10(8)6-9-7/h2,4,9H,3,5-6H2,1H3.
What are the key properties of 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine?
1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine has a molecular weight of 136.20 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3,5,6-tetrahydroimidazo[1,5-a]pyridine is sourced from PubChem (CID 89292642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).