C10H19N3 — CID 142199276
2-methyl-1-[(2S,4Z,6Z)-octa-4,6-dien-2-yl]guanidine (PubChem CID 142199276) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-methyl-1-[(2S,4Z,6Z)-octa-4,6-dien-2-yl]guanidine.
| Compound Name | 2-methyl-1-[(2S,4Z,6Z)-octa-4,6-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 142199276 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-methyl-1-[(2S,4Z,6Z)-octa-4,6-dien-2-yl]guanidine |
| SMILES | C/C=C\C=C/C[C@H](C)N/C(N)=N/C |
| InChI | InChI=1S/C10H19N3/c1-4-5-6-7-8-9(2)13-10(11)12-3/h4-7,9H,8H2,1-3H3,(H3,11,12,13)/b5-4-,7-6-/t9-/m0/s1 |
| InChIKey | SOQXWCUAMQRCHB-RVFQFHBHSA-N |
| XLogP | 1.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|