C25H23N — CID 142200345
acetylene;2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[(E)-2-naphthalen-1-ylethenyl]pyridine (PubChem CID 142200345) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is acetylene;2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[(E)-2-naphthalen-1-ylethenyl]pyridine.
| Compound Name | acetylene;2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[(E)-2-naphthalen-1-ylethenyl]pyridine |
|---|---|
| PubChem CID | 142200345 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | acetylene;2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[(E)-2-naphthalen-1-ylethenyl]pyridine |
| SMILES | C#C.C/C=C\C=C/Cc1cc(/C=C/c2cccc3ccccc23)ccn1 |
| InChI | InChI=1S/C23H21N.C2H2/c1-2-3-4-5-12-22-18-19(16-17-24-22)14-15-21-11-8-10-20-9-6-7-13-23(20)21;1-2/h2-11,13-18H,12H2,1H3;1-2H/b3-2-,5-4-,15-14+; |
| InChIKey | GNXOSNLAGJFWBK-MBOCEEEGSA-N |
| XLogP | 6.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|