C32H27F3N4O3 — CID 142201167
formamide;N-(1-phenylethyl)-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-1H-indole-2-carboxamide (PubChem CID 142201167) has the molecular formula C32H27F3N4O3 and a molecular weight of 572.59 g/mol. Its IUPAC name is formamide;N-(1-phenylethyl)-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-1H-indole-2-carboxamide.
| Compound Name | formamide;N-(1-phenylethyl)-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142201167 |
| Molecular Formula | C32H27F3N4O3 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | formamide;N-(1-phenylethyl)-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-1H-indole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2cc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)ccc2[nH]1)c1ccccc1.NC=O |
| InChI | InChI=1S/C31H24F3N3O2.CH3NO/c1-19(20-7-3-2-4-8-20)35-30(39)28-18-22-17-24(15-16-27(22)37-28)36-29(38)26-10-6-5-9-25(26)21-11-13-23(14-12-21)31(32,33)34;2-1-3/h2-19,37H,1H3,(H,35,39)(H,36,38);1H,(H2,2,3) |
| InChIKey | WIRRGTHEXLCOHC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|