C12H22N2O — CID 142202951
1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]piperazine (PubChem CID 142202951) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]piperazine.
| Compound Name | 1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]piperazine |
|---|---|
| PubChem CID | 142202951 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]piperazine |
| SMILES | C=C(CC/C(=C\C)N1CCNCC1)OC |
| InChI | InChI=1S/C12H22N2O/c1-4-12(6-5-11(2)15-3)14-9-7-13-8-10-14/h4,13H,2,5-10H2,1,3H3/b12-4+ |
| InChIKey | XGHKKTSAOAWPBG-UUILKARUSA-N |
| XLogP | 1.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|