C10H17N2O- — CID 142040884
2-[(4-methoxycyclohexa-1,3-dien-1-yl)amino]ethyl-methylazanide (PubChem CID 142040884) has the molecular formula C10H17N2O- and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-[(4-methoxycyclohexa-1,3-dien-1-yl)amino]ethyl-methylazanide.
| Compound Name | 2-[(4-methoxycyclohexa-1,3-dien-1-yl)amino]ethyl-methylazanide |
|---|---|
| PubChem CID | 142040884 |
| Molecular Formula | C10H17N2O- |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-[(4-methoxycyclohexa-1,3-dien-1-yl)amino]ethyl-methylazanide |
| SMILES | C[N-]CCNC1=CC=C(OC)CC1 |
| InChI | InChI=1S/C10H17N2O/c1-11-7-8-12-9-3-5-10(13-2)6-4-9/h3,5,12H,4,6-8H2,1-2H3/q-1 |
| InChIKey | ASVCKQZYLNTXOB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|