C13H27NO — CID 143108392
ethane;(3E,5E)-6-methoxy-N-propylhepta-3,5-dien-3-amine (PubChem CID 143108392) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is ethane;(3E,5E)-6-methoxy-N-propylhepta-3,5-dien-3-amine.
| Compound Name | ethane;(3E,5E)-6-methoxy-N-propylhepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 143108392 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | ethane;(3E,5E)-6-methoxy-N-propylhepta-3,5-dien-3-amine |
| SMILES | CC.CCCN/C(=C/C=C(\C)OC)CC |
| InChI | InChI=1S/C11H21NO.C2H6/c1-5-9-12-11(6-2)8-7-10(3)13-4;1-2/h7-8,12H,5-6,9H2,1-4H3;1-2H3/b10-7+,11-8+; |
| InChIKey | YOJVUVPQRFCFIC-YXFMPUTOSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|