C12H21FN2O — CID 163593329
5-fluoro-2-N-(4-methoxybutyl)-1-N-methylcyclohexa-2,4-diene-1,2-diamine (PubChem CID 163593329) has the molecular formula C12H21FN2O and a molecular weight of 228.31 g/mol. Its IUPAC name is 5-fluoro-2-N-(4-methoxybutyl)-1-N-methylcyclohexa-2,4-diene-1,2-diamine.
| Compound Name | 5-fluoro-2-N-(4-methoxybutyl)-1-N-methylcyclohexa-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 163593329 |
| Molecular Formula | C12H21FN2O |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 5-fluoro-2-N-(4-methoxybutyl)-1-N-methylcyclohexa-2,4-diene-1,2-diamine |
| SMILES | CNC1CC(F)=CC=C1NCCCCOC |
| InChI | InChI=1S/C12H21FN2O/c1-14-12-9-10(13)5-6-11(12)15-7-3-4-8-16-2/h5-6,12,14-15H,3-4,7-9H2,1-2H3 |
| InChIKey | GRJFXLQLUBAHEY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|