C10H16N2O — CID 142040619
1-(4-methoxycyclohexa-1,3-dien-1-yl)imidazolidine (PubChem CID 142040619) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(4-methoxycyclohexa-1,3-dien-1-yl)imidazolidine.
| Compound Name | 1-(4-methoxycyclohexa-1,3-dien-1-yl)imidazolidine |
|---|---|
| PubChem CID | 142040619 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(4-methoxycyclohexa-1,3-dien-1-yl)imidazolidine |
| SMILES | COC1=CC=C(N2CCNC2)CC1 |
| InChI | InChI=1S/C10H16N2O/c1-13-10-4-2-9(3-5-10)12-7-6-11-8-12/h2,4,11H,3,5-8H2,1H3 |
| InChIKey | KRNLBVAVTPLJNG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |