C12H20N2O — CID 142202932
1-[(3E,5E)-6-methoxyocta-1,3,5-trien-3-yl]imidazolidine (PubChem CID 142202932) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[(3E,5E)-6-methoxyocta-1,3,5-trien-3-yl]imidazolidine.
| Compound Name | 1-[(3E,5E)-6-methoxyocta-1,3,5-trien-3-yl]imidazolidine |
|---|---|
| PubChem CID | 142202932 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[(3E,5E)-6-methoxyocta-1,3,5-trien-3-yl]imidazolidine |
| SMILES | C=C/C(=C\C=C(/CC)OC)N1CCNC1 |
| InChI | InChI=1S/C12H20N2O/c1-4-11(14-9-8-13-10-14)6-7-12(5-2)15-3/h4,6-7,13H,1,5,8-10H2,2-3H3/b11-6+,12-7+ |
| InChIKey | LQMCKBMPIFTIDV-GNXRPPCSSA-N |
| XLogP | 1.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|