C18H30N2O2 — CID 142203256
ethane;N-(3-ethyl-5-hydroxyphenyl)-3-piperidin-1-ylpropanamide (PubChem CID 142203256) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethane;N-(3-ethyl-5-hydroxyphenyl)-3-piperidin-1-ylpropanamide.
| Compound Name | ethane;N-(3-ethyl-5-hydroxyphenyl)-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 142203256 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | ethane;N-(3-ethyl-5-hydroxyphenyl)-3-piperidin-1-ylpropanamide |
| SMILES | CC.CCc1cc(O)cc(NC(=O)CCN2CCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O2.C2H6/c1-2-13-10-14(12-15(19)11-13)17-16(20)6-9-18-7-4-3-5-8-18;1-2/h10-12,19H,2-9H2,1H3,(H,17,20);1-2H3 |
| InChIKey | IKPZAVKFSWSDSI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |