C36H51NO2 — CID 142203858
N-(3-heptan-4-ylphenyl)-2-methylpropanamide;pentan-2-ylbenzene;1-phenylethanone (PubChem CID 142203858) has the molecular formula C36H51NO2 and a molecular weight of 529.81 g/mol. Its IUPAC name is N-(3-heptan-4-ylphenyl)-2-methylpropanamide;pentan-2-ylbenzene;1-phenylethanone.
| Compound Name | N-(3-heptan-4-ylphenyl)-2-methylpropanamide;pentan-2-ylbenzene;1-phenylethanone |
|---|---|
| PubChem CID | 142203858 |
| Molecular Formula | C36H51NO2 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.39 |
| IUPAC Name | N-(3-heptan-4-ylphenyl)-2-methylpropanamide;pentan-2-ylbenzene;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.CCCC(C)c1ccccc1.CCCC(CCC)c1cccc(NC(=O)C(C)C)c1 |
| InChI | InChI=1S/C17H27NO.C11H16.C8H8O/c1-5-8-14(9-6-2)15-10-7-11-16(12-15)18-17(19)13(3)4;1-3-7-10(2)11-8-5-4-6-9-11;1-7(9)8-5-3-2-4-6-8/h7,10-14H,5-6,8-9H2,1-4H3,(H,18,19);4-6,8-10H,3,7H2,1-2H3;2-6H,1H3 |
| InChIKey | GOROKUNCDHCOJR-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |