C16H30N2O — CID 142494224
1-(3-hexan-3-ylphenyl)-3-propan-2-ylurea;molecular hydrogen (PubChem CID 142494224) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-(3-hexan-3-ylphenyl)-3-propan-2-ylurea;molecular hydrogen.
| Compound Name | 1-(3-hexan-3-ylphenyl)-3-propan-2-ylurea;molecular hydrogen |
|---|---|
| PubChem CID | 142494224 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-(3-hexan-3-ylphenyl)-3-propan-2-ylurea;molecular hydrogen |
| SMILES | CCCC(CC)c1cccc(NC(=O)NC(C)C)c1.[H][H].[H][H] |
| InChI | InChI=1S/C16H26N2O.2H2/c1-5-8-13(6-2)14-9-7-10-15(11-14)18-16(19)17-12(3)4;;/h7,9-13H,5-6,8H2,1-4H3,(H2,17,18,19);2*1H |
| InChIKey | RLKVCTZFCDZRSW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |