C15H21N3OS2 — CID 138601693
1-[3-[1-cyano-3-(methyldisulfanyl)propan-2-yl]phenyl]-3-propan-2-ylurea (PubChem CID 138601693) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 1-[3-[1-cyano-3-(methyldisulfanyl)propan-2-yl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[1-cyano-3-(methyldisulfanyl)propan-2-yl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 138601693 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[3-[1-cyano-3-(methyldisulfanyl)propan-2-yl]phenyl]-3-propan-2-ylurea |
| SMILES | CSSCC(CC#N)c1cccc(NC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C15H21N3OS2/c1-11(2)17-15(19)18-14-6-4-5-12(9-14)13(7-8-16)10-21-20-3/h4-6,9,11,13H,7,10H2,1-3H3,(H2,17,18,19) |
| InChIKey | NAAMJEWRAVBYEE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|