C31H43F2N3O5S — CID 142205153
N-[(2S,3S,4R,5R)-1-(3,5-difluorophenyl)-3-hydroxy-4,6-dimethyl-5-(2-methylpropylcarbamoyl)heptan-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 142205153) has the molecular formula C31H43F2N3O5S and a molecular weight of 607.76 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R)-1-(3,5-difluorophenyl)-3-hydroxy-4,6-dimethyl-5-(2-methylpropylcarbamoyl)heptan-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2S,3S,4R,5R)-1-(3,5-difluorophenyl)-3-hydroxy-4,6-dimethyl-5-(2-methylpropylcarbamoyl)heptan-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 142205153 |
| Molecular Formula | C31H43F2N3O5S |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | N-[(2S,3S,4R,5R)-1-(3,5-difluorophenyl)-3-hydroxy-4,6-dimethyl-5-(2-methylpropylcarbamoyl)heptan-2-yl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)CNC(=O)[C@H](C(C)C)[C@@H](C)[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C31H43F2N3O5S/c1-19(2)18-34-31(39)28(20(3)4)21(5)29(37)27(16-22-14-24(32)17-25(33)15-22)35-30(38)23-8-10-26(11-9-23)42(40,41)36-12-6-7-13-36/h8-11,14-15,17,19-21,27-29,37H,6-7,12-13,16,18H2,1-5H3,(H,34,39)(H,35,38)/t21-,27+,28-,29+/m1/s1 |
| InChIKey | WWOGACHASYVQTK-UQMGHXSLSA-N |
| XLogP | 4.13 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |