C28H39N3O4S — CID 142205144
N-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-4-pyrrolidin-1-ylsulfanylbenzamide (PubChem CID 142205144) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-4-pyrrolidin-1-ylsulfanylbenzamide.
| Compound Name | N-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-4-pyrrolidin-1-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 142205144 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxo-1-phenylhexan-2-yl]-4-pyrrolidin-1-ylsulfanylbenzamide |
| SMILES | CC(C)CNC(=O)[C@H](C)[C@@H](O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1ccc(SN2CCCC2)cc1 |
| InChI | InChI=1S/C28H39N3O4S/c1-19(2)18-29-27(34)20(3)25(32)26(33)24(17-21-9-5-4-6-10-21)30-28(35)22-11-13-23(14-12-22)36-31-15-7-8-16-31/h4-6,9-14,19-20,24-26,32-33H,7-8,15-18H2,1-3H3,(H,29,34)(H,30,35)/t20-,24+,25-,26-/m1/s1 |
| InChIKey | OZUZMBNCBIJACQ-JFWNMISASA-N |
| XLogP | 3.26 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|