C19H33NO4 — CID 142205934
methyl 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetate (PubChem CID 142205934) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is methyl 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetate.
| Compound Name | methyl 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetate |
|---|---|
| PubChem CID | 142205934 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | methyl 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetate |
| SMILES | CCCCCC/C=C/C1CCC(=O)N1CCCCOCC(=O)OC |
| InChI | InChI=1S/C19H33NO4/c1-3-4-5-6-7-8-11-17-12-13-18(21)20(17)14-9-10-15-24-16-19(22)23-2/h8,11,17H,3-7,9-10,12-16H2,1-2H3/b11-8+ |
| InChIKey | RGLDRXHRAHONPR-DHZHZOJOSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|