C19H31NO5 — CID 20755518
methyl 2-[4-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]butoxy]acetate (PubChem CID 20755518) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl 2-[4-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]butoxy]acetate.
| Compound Name | methyl 2-[4-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]butoxy]acetate |
|---|---|
| PubChem CID | 20755518 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | methyl 2-[4-[2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]butoxy]acetate |
| SMILES | CCCCCC(=O)/C=C/C1CCC(=O)N1CCCCOCC(=O)OC |
| InChI | InChI=1S/C19H31NO5/c1-3-4-5-8-17(21)11-9-16-10-12-18(22)20(16)13-6-7-14-25-15-19(23)24-2/h9,11,16H,3-8,10,12-15H2,1-2H3/b11-9+ |
| InChIKey | PDGIUJDGAGZFSW-PKNBQFBNSA-N |
| XLogP | 2.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|